C13H15FN2O — CID 113270323
2-cyano-N-(3-fluorophenyl)-N,2-dimethylbutanamide (PubChem CID 113270323) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-cyano-N-(3-fluorophenyl)-N,2-dimethylbutanamide.
| Compound Name | 2-cyano-N-(3-fluorophenyl)-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 113270323 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-cyano-N-(3-fluorophenyl)-N,2-dimethylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O/c1-4-13(2,9-15)12(17)16(3)11-7-5-6-10(14)8-11/h5-8H,4H2,1-3H3 |
| InChIKey | IADVDQVQNRRYTG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |