C14H16F3N3 — CID 144916595
3-[methyl-[(2Z)-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzenecarboximidamide (PubChem CID 144916595) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-[methyl-[(2Z)-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzenecarboximidamide.
| Compound Name | 3-[methyl-[(2Z)-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 144916595 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-[methyl-[(2Z)-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)/C(C)=C\C(=C)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N3/c1-9(14(15,16)17)7-10(2)20(3)12-6-4-5-11(8-12)13(18)19/h4-8H,1H2,2-3H3,(H3,18,19)/b10-7- |
| InChIKey | OEALBFLHTDGMJF-YFHOEESVSA-N |
| XLogP | 3.43 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|