About 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide
3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide (PubChem CID 55142333) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide |
| PubChem CID | 55142333 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H17N3O2S/c1-15(11-5-6-18(16,17)8-11)10-4-2-3-9(7-10)12(13)14/h2-4,7,11H,5-6,8H2,1H3,(H3,13,14) |
| InChIKey | JBBXORZHRKGKED-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide (CID 55142333) is 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide is [H]/N=C(\N)c1cccc(N(C)C2CCS(=O)(=O)C2)c1.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide?
The InChIKey is JBBXORZHRKGKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-15(11-5-6-18(16,17)8-11)10-4-2-3-9(7-10)12(13)14/h2-4,7,11H,5-6,8H2,1H3,(H3,13,14).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide?
3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide has a molecular weight of 267.35 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide is sourced from PubChem (CID 55142333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).