C12H17N3O2S — CID 55142333
3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide (PubChem CID 55142333) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 55142333 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H17N3O2S/c1-15(11-5-6-18(16,17)8-11)10-4-2-3-9(7-10)12(13)14/h2-4,7,11H,5-6,8H2,1H3,(H3,13,14) |
| InChIKey | JBBXORZHRKGKED-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|