C11H15N3O2S2 — CID 115488276
5-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-2-carbothioamide (PubChem CID 115488276) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-2-carbothioamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488276 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-2-carbothioamide |
| SMILES | CN(c1ccc(C(N)=S)nc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-14(9-4-5-18(15,16)7-9)8-2-3-10(11(12)17)13-6-8/h2-3,6,9H,4-5,7H2,1H3,(H2,12,17) |
| InChIKey | JXXYXPLBEPNGAZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|