C11H16N4O2S2 — CID 107546694
2-[(1,1-dioxothiolan-3-yl)-methylamino]-6-methylpyrimidine-4-carbothioamide (PubChem CID 107546694) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546694 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-6-methylpyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(N(C)C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H16N4O2S2/c1-7-5-9(10(12)18)14-11(13-7)15(2)8-3-4-19(16,17)6-8/h5,8H,3-4,6H2,1-2H3,(H2,12,18) |
| InChIKey | OGDXCZRWOIBQLZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|