C13H18FN3O2S — CID 107117783
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-fluorobenzenecarboximidamide (PubChem CID 107117783) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-fluorobenzenecarboximidamide.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107117783 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(C)C2CCS(=O)(=O)C2)c1F |
| InChI | InChI=1S/C13H18FN3O2S/c1-17(10-5-6-20(18,19)8-10)7-9-3-2-4-11(12(9)14)13(15)16/h2-4,10H,5-8H2,1H3,(H3,15,16) |
| InChIKey | YDHPRJXGDQQPBO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|