C15H25FN4 — CID 107117880
3-[[2-(dimethylamino)ethyl-propylamino]methyl]-2-fluorobenzenecarboximidamide (PubChem CID 107117880) has the molecular formula C15H25FN4 and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)ethyl-propylamino]methyl]-2-fluorobenzenecarboximidamide.
| Compound Name | 3-[[2-(dimethylamino)ethyl-propylamino]methyl]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107117880 |
| Molecular Formula | C15H25FN4 |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 3-[[2-(dimethylamino)ethyl-propylamino]methyl]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(CCC)CCN(C)C)c1F |
| InChI | InChI=1S/C15H25FN4/c1-4-8-20(10-9-19(2)3)11-12-6-5-7-13(14(12)16)15(17)18/h5-7H,4,8-11H2,1-3H3,(H3,17,18) |
| InChIKey | CSJLOAGRXRRHIJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|