C13H17FN2O2S2 — CID 43648747
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzenecarbothioamide (PubChem CID 43648747) has the molecular formula C13H17FN2O2S2 and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzenecarbothioamide.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 43648747 |
| Molecular Formula | C13H17FN2O2S2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzenecarbothioamide |
| SMILES | CN(Cc1cc(C(N)=S)ccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17FN2O2S2/c1-16(11-4-5-20(17,18)8-11)7-10-6-9(13(15)19)2-3-12(10)14/h2-3,6,11H,4-5,7-8H2,1H3,(H2,15,19) |
| InChIKey | FIVDKULOZDIGOX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|