C13H18FN3O3S — CID 107458448
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzohydrazide (PubChem CID 107458448) has the molecular formula C13H18FN3O3S and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107458448 |
| Molecular Formula | C13H18FN3O3S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-fluorobenzohydrazide |
| SMILES | CN(Cc1cc(C(=O)NN)ccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18FN3O3S/c1-17(11-4-5-21(19,20)8-11)7-10-6-9(13(18)16-15)2-3-12(10)14/h2-3,6,11H,4-5,7-8,15H2,1H3,(H,16,18) |
| InChIKey | CBBTXKYDHMCLSP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|