C11H17N3O4S — CID 63573141
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]furan-2-carbohydrazide (PubChem CID 63573141) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]furan-2-carbohydrazide.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63573141 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]furan-2-carbohydrazide |
| SMILES | CN(Cc1ccoc1C(=O)NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17N3O4S/c1-14(9-3-5-19(16,17)7-9)6-8-2-4-18-10(8)11(15)13-12/h2,4,9H,3,5-7,12H2,1H3,(H,13,15) |
| InChIKey | PAQGZJQMTCZFDN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|