C11H16N4O4S — CID 114467292
propan-2-yl N-[(3-carbamimidoylphenyl)sulfamoyl]carbamate (PubChem CID 114467292) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is propan-2-yl N-[(3-carbamimidoylphenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(3-carbamimidoylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467292 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | propan-2-yl N-[(3-carbamimidoylphenyl)sulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(NS(=O)(=O)NC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C11H16N4O4S/c1-7(2)19-11(16)15-20(17,18)14-9-5-3-4-8(6-9)10(12)13/h3-7,14H,1-2H3,(H3,12,13)(H,15,16) |
| InChIKey | CEABXKRTZSQNPQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|