C9H18N6O2S — CID 136994567
1-methyl-5-(2-methylpropylsulfamoylamino)pyrazole-4-carboximidamide (PubChem CID 136994567) has the molecular formula C9H18N6O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-methyl-5-(2-methylpropylsulfamoylamino)pyrazole-4-carboximidamide.
| Compound Name | 1-methyl-5-(2-methylpropylsulfamoylamino)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 136994567 |
| Molecular Formula | C9H18N6O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-methyl-5-(2-methylpropylsulfamoylamino)pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnn(C)c1NS(=O)(=O)NCC(C)C |
| InChI | InChI=1S/C9H18N6O2S/c1-6(2)4-13-18(16,17)14-9-7(8(10)11)5-12-15(9)3/h5-6,13-14H,4H2,1-3H3,(H3,10,11) |
| InChIKey | QKRNXAWWWHEROX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|