C7H12N4O4S3 — CID 82843239
1-methyl-5-(methylsulfonylmethylsulfonylamino)pyrazole-4-carbothioamide (PubChem CID 82843239) has the molecular formula C7H12N4O4S3 and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-methyl-5-(methylsulfonylmethylsulfonylamino)pyrazole-4-carbothioamide.
| Compound Name | 1-methyl-5-(methylsulfonylmethylsulfonylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 82843239 |
| Molecular Formula | C7H12N4O4S3 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1-methyl-5-(methylsulfonylmethylsulfonylamino)pyrazole-4-carbothioamide |
| SMILES | Cn1ncc(C(N)=S)c1NS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C7H12N4O4S3/c1-11-7(5(3-9-11)6(8)16)10-18(14,15)4-17(2,12)13/h3,10H,4H2,1-2H3,(H2,8,16) |
| InChIKey | AGZAUFRBVLEDOY-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|