C18H15F2N3O4S — CID 171777335
ethyl 1-(4-fluorophenyl)-5-[(2-fluorophenyl)sulfonylamino]pyrazole-4-carboxylate (PubChem CID 171777335) has the molecular formula C18H15F2N3O4S and a molecular weight of 407.40 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-5-[(2-fluorophenyl)sulfonylamino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-5-[(2-fluorophenyl)sulfonylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 171777335 |
| Molecular Formula | C18H15F2N3O4S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-5-[(2-fluorophenyl)sulfonylamino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(F)cc2)c1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C18H15F2N3O4S/c1-2-27-18(24)14-11-21-23(13-9-7-12(19)8-10-13)17(14)22-28(25,26)16-6-4-3-5-15(16)20/h3-11,22H,2H2,1H3 |
| InChIKey | QLZLEVQSZGTZNA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |