C12H10N2O4S — CID 113326121
methyl 3-nitro-5-(1,3-thiazol-2-ylmethyl)benzoate (PubChem CID 113326121) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is methyl 3-nitro-5-(1,3-thiazol-2-ylmethyl)benzoate.
| Compound Name | methyl 3-nitro-5-(1,3-thiazol-2-ylmethyl)benzoate |
|---|---|
| PubChem CID | 113326121 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | methyl 3-nitro-5-(1,3-thiazol-2-ylmethyl)benzoate |
| SMILES | COC(=O)c1cc(Cc2nccs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N2O4S/c1-18-12(15)9-4-8(5-10(7-9)14(16)17)6-11-13-2-3-19-11/h2-5,7H,6H2,1H3 |
| InChIKey | NMSUSHGGXKKIQG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|