C22H28N2O7 — CID 69105434
[4-(hydroxymethyl)-2-nitrophenyl] 11-(2,5-dioxopyrrol-1-yl)undecanoate (PubChem CID 69105434) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2-nitrophenyl] 11-(2,5-dioxopyrrol-1-yl)undecanoate.
| Compound Name | [4-(hydroxymethyl)-2-nitrophenyl] 11-(2,5-dioxopyrrol-1-yl)undecanoate |
|---|---|
| PubChem CID | 69105434 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [4-(hydroxymethyl)-2-nitrophenyl] 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| SMILES | O=C(CCCCCCCCCCN1C(=O)C=CC1=O)Oc1ccc(CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O7/c25-16-17-10-11-19(18(15-17)24(29)30)31-22(28)9-7-5-3-1-2-4-6-8-14-23-20(26)12-13-21(23)27/h10-13,15,25H,1-9,14,16H2 |
| InChIKey | CYPDYVRFMFGCSV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|