C10H12NO6S- — CID 174655893
6-(2,5-dioxopyrrol-1-yl)hexanoyl sulfite (PubChem CID 174655893) has the molecular formula C10H12NO6S- and a molecular weight of 274.27 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanoyl sulfite.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyl sulfite |
|---|---|
| PubChem CID | 174655893 |
| Molecular Formula | C10H12NO6S- |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyl sulfite |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OS(=O)[O-] |
| InChI | InChI=1S/C10H13NO6S/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)17-18(15)16/h5-6H,1-4,7H2,(H,15,16)/p-1 |
| InChIKey | BXNUSFPLULMDLN-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|