C28H25NO5 — CID 68826828
3-[3-naphthalen-2-yl-5-nitro-4-(3-phenylpropoxy)phenyl]propanoic acid (PubChem CID 68826828) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-[3-naphthalen-2-yl-5-nitro-4-(3-phenylpropoxy)phenyl]propanoic acid.
| Compound Name | 3-[3-naphthalen-2-yl-5-nitro-4-(3-phenylpropoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 68826828 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[3-naphthalen-2-yl-5-nitro-4-(3-phenylpropoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(-c2ccc3ccccc3c2)c(OCCCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25NO5/c30-27(31)15-12-21-17-25(24-14-13-22-10-4-5-11-23(22)19-24)28(26(18-21)29(32)33)34-16-6-9-20-7-2-1-3-8-20/h1-5,7-8,10-11,13-14,17-19H,6,9,12,15-16H2,(H,30,31) |
| InChIKey | OAMBRMMDZAJPKL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|