C29H27NO5 — CID 22558791
methyl 3-[4-[2-(4-methylphenyl)ethoxy]-3-naphthalen-2-yl-5-nitrophenyl]propanoate (PubChem CID 22558791) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 3-[4-[2-(4-methylphenyl)ethoxy]-3-naphthalen-2-yl-5-nitrophenyl]propanoate.
| Compound Name | methyl 3-[4-[2-(4-methylphenyl)ethoxy]-3-naphthalen-2-yl-5-nitrophenyl]propanoate |
|---|---|
| PubChem CID | 22558791 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | methyl 3-[4-[2-(4-methylphenyl)ethoxy]-3-naphthalen-2-yl-5-nitrophenyl]propanoate |
| SMILES | COC(=O)CCc1cc(-c2ccc3ccccc3c2)c(OCCc2ccc(C)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27NO5/c1-20-7-9-21(10-8-20)15-16-35-29-26(25-13-12-23-5-3-4-6-24(23)19-25)17-22(11-14-28(31)34-2)18-27(29)30(32)33/h3-10,12-13,17-19H,11,14-16H2,1-2H3 |
| InChIKey | AHQLOSYIPVWKNA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|