C21H26O4 — CID 22616555
methyl 4-[4-(2-hydroxybutoxy)-3-phenylphenyl]butanoate (PubChem CID 22616555) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 4-[4-(2-hydroxybutoxy)-3-phenylphenyl]butanoate.
| Compound Name | methyl 4-[4-(2-hydroxybutoxy)-3-phenylphenyl]butanoate |
|---|---|
| PubChem CID | 22616555 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | methyl 4-[4-(2-hydroxybutoxy)-3-phenylphenyl]butanoate |
| SMILES | CCC(O)COc1ccc(CCCC(=O)OC)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H26O4/c1-3-18(22)15-25-20-13-12-16(8-7-11-21(23)24-2)14-19(20)17-9-5-4-6-10-17/h4-6,9-10,12-14,18,22H,3,7-8,11,15H2,1-2H3 |
| InChIKey | YVVFZHFLIJDUEV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |