C17H15Br2NO5 — CID 71425932
methyl 4-[3,5-dibromo-4-(4-nitrophenoxy)phenyl]butanoate (PubChem CID 71425932) has the molecular formula C17H15Br2NO5 and a molecular weight of 473.12 g/mol. Its IUPAC name is methyl 4-[3,5-dibromo-4-(4-nitrophenoxy)phenyl]butanoate.
| Compound Name | methyl 4-[3,5-dibromo-4-(4-nitrophenoxy)phenyl]butanoate |
|---|---|
| PubChem CID | 71425932 |
| Molecular Formula | C17H15Br2NO5 |
| Molecular Weight | 473.12 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | methyl 4-[3,5-dibromo-4-(4-nitrophenoxy)phenyl]butanoate |
| SMILES | COC(=O)CCCc1cc(Br)c(Oc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C17H15Br2NO5/c1-24-16(21)4-2-3-11-9-14(18)17(15(19)10-11)25-13-7-5-12(6-8-13)20(22)23/h5-10H,2-4H2,1H3 |
| InChIKey | PRNDTETYOVZBKX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.12 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|