C16H12Br2FNO5 — CID 143574007
methyl 3-[3,5-dibromo-2-fluoro-4-(4-nitrophenoxy)phenyl]propanoate (PubChem CID 143574007) has the molecular formula C16H12Br2FNO5 and a molecular weight of 477.08 g/mol. Its IUPAC name is methyl 3-[3,5-dibromo-2-fluoro-4-(4-nitrophenoxy)phenyl]propanoate.
| Compound Name | methyl 3-[3,5-dibromo-2-fluoro-4-(4-nitrophenoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 143574007 |
| Molecular Formula | C16H12Br2FNO5 |
| Molecular Weight | 477.08 g/mol |
| Exact Mass | 474.91 |
| IUPAC Name | methyl 3-[3,5-dibromo-2-fluoro-4-(4-nitrophenoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(Br)c(Oc2ccc([N+](=O)[O-])cc2)c(Br)c1F |
| InChI | InChI=1S/C16H12Br2FNO5/c1-24-13(21)7-2-9-8-12(17)16(14(18)15(9)19)25-11-5-3-10(4-6-11)20(22)23/h3-6,8H,2,7H2,1H3 |
| InChIKey | NJKYSJOIZRCOTD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|