C17H14BBrN2O6 — CID 89323408
CID 89323408 (PubChem CID 89323408) has the molecular formula C17H14BBrN2O6 and a molecular weight of 433.02 g/mol.
| Compound Name | CID 89323408 |
|---|---|
| PubChem CID | 89323408 |
| Molecular Formula | C17H14BBrN2O6 |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NCCC(=O)OC)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14BBrN2O6/c1-26-15(22)6-7-20-17(23)10-8-13(18)16(14(19)9-10)27-12-4-2-11(3-5-12)21(24)25/h2-5,8-9H,6-7H2,1H3,(H,20,23) |
| InChIKey | GMXPAHISMORGMV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|