C28H26FNO3 — CID 68829380
3-[3-amino-4-[2-(2-fluorophenyl)ethoxy]-5-naphthalen-2-ylphenyl]-2-methylpropanoic acid (PubChem CID 68829380) has the molecular formula C28H26FNO3 and a molecular weight of 443.52 g/mol. Its IUPAC name is 3-[3-amino-4-[2-(2-fluorophenyl)ethoxy]-5-naphthalen-2-ylphenyl]-2-methylpropanoic acid.
| Compound Name | 3-[3-amino-4-[2-(2-fluorophenyl)ethoxy]-5-naphthalen-2-ylphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68829380 |
| Molecular Formula | C28H26FNO3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-[3-amino-4-[2-(2-fluorophenyl)ethoxy]-5-naphthalen-2-ylphenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1cc(N)c(OCCc2ccccc2F)c(-c2ccc3ccccc3c2)c1)C(=O)O |
| InChI | InChI=1S/C28H26FNO3/c1-18(28(31)32)14-19-15-24(23-11-10-20-6-2-3-8-22(20)17-23)27(26(30)16-19)33-13-12-21-7-4-5-9-25(21)29/h2-11,15-18H,12-14,30H2,1H3,(H,31,32) |
| InChIKey | DGDNSGITKGRUAZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|