C23H21ClFNO2 — CID 141125141
5-chloro-2-[2-(2-fluorophenyl)ethoxy]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 141125141) has the molecular formula C23H21ClFNO2 and a molecular weight of 397.88 g/mol. Its IUPAC name is 5-chloro-2-[2-(2-fluorophenyl)ethoxy]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 5-chloro-2-[2-(2-fluorophenyl)ethoxy]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 141125141 |
| Molecular Formula | C23H21ClFNO2 |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-chloro-2-[2-(2-fluorophenyl)ethoxy]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1cc(Cl)ccc1OCCc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C23H21ClFNO2/c1-16(17-7-3-2-4-8-17)26-23(27)20-15-19(24)11-12-22(20)28-14-13-18-9-5-6-10-21(18)25/h2-12,15-16H,13-14H2,1H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | WSCLWMFOSLZGDL-INIZCTEOSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |