C23H21ClN2O4 — CID 70328500
4-[(1S)-1-[[2-[(2-aminophenyl)methoxy]-5-chlorobenzoyl]amino]ethyl]benzoic acid (PubChem CID 70328500) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is 4-[(1S)-1-[[2-[(2-aminophenyl)methoxy]-5-chlorobenzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[2-[(2-aminophenyl)methoxy]-5-chlorobenzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70328500 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-[(1S)-1-[[2-[(2-aminophenyl)methoxy]-5-chlorobenzoyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1cc(Cl)ccc1OCc1ccccc1N)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-14(15-6-8-16(9-7-15)23(28)29)26-22(27)19-12-18(24)10-11-21(19)30-13-17-4-2-3-5-20(17)25/h2-12,14H,13,25H2,1H3,(H,26,27)(H,28,29)/t14-/m0/s1 |
| InChIKey | TVRGHEABHVKRMK-AWEZNQCLSA-N |
| XLogP | 4.69 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|