C23H28ClNO5 — CID 68880285
ethyl 4-[(1S)-1-[[5-chloro-2-(2-propan-2-yloxyethoxy)benzoyl]amino]ethyl]benzoate (PubChem CID 68880285) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is ethyl 4-[(1S)-1-[[5-chloro-2-(2-propan-2-yloxyethoxy)benzoyl]amino]ethyl]benzoate.
| Compound Name | ethyl 4-[(1S)-1-[[5-chloro-2-(2-propan-2-yloxyethoxy)benzoyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 68880285 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | ethyl 4-[(1S)-1-[[5-chloro-2-(2-propan-2-yloxyethoxy)benzoyl]amino]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@H](C)NC(=O)c2cc(Cl)ccc2OCCOC(C)C)cc1 |
| InChI | InChI=1S/C23H28ClNO5/c1-5-28-23(27)18-8-6-17(7-9-18)16(4)25-22(26)20-14-19(24)10-11-21(20)30-13-12-29-15(2)3/h6-11,14-16H,5,12-13H2,1-4H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | WKUNYYBYTNZVIR-INIZCTEOSA-N |
| XLogP | 4.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|