C22H16ClF2NO4 — CID 11510286
4-[(1S)-1-[[5-chloro-2-(2,3-difluorophenoxy)benzoyl]amino]ethyl]benzoic acid (PubChem CID 11510286) has the molecular formula C22H16ClF2NO4 and a molecular weight of 431.82 g/mol. Its IUPAC name is 4-[(1S)-1-[[5-chloro-2-(2,3-difluorophenoxy)benzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[5-chloro-2-(2,3-difluorophenoxy)benzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 11510286 |
| Molecular Formula | C22H16ClF2NO4 |
| Molecular Weight | 431.82 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 4-[(1S)-1-[[5-chloro-2-(2,3-difluorophenoxy)benzoyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1cc(Cl)ccc1Oc1cccc(F)c1F)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H16ClF2NO4/c1-12(13-5-7-14(8-6-13)22(28)29)26-21(27)16-11-15(23)9-10-18(16)30-19-4-2-3-17(24)20(19)25/h2-12H,1H3,(H,26,27)(H,28,29)/t12-/m0/s1 |
| InChIKey | ZGFNLKCVKKEJKU-LBPRGKRZSA-N |
| XLogP | 5.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.82 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |