C21H18Cl2N2O2 — CID 141442192
5-chloro-2-[(4-chlorophenoxy)methyl]-N-[(1S)-1-phenylethyl]pyridine-3-carboxamide (PubChem CID 141442192) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenoxy)methyl]-N-[(1S)-1-phenylethyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-[(4-chlorophenoxy)methyl]-N-[(1S)-1-phenylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141442192 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenoxy)methyl]-N-[(1S)-1-phenylethyl]pyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(Cl)cnc1COc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H18Cl2N2O2/c1-14(15-5-3-2-4-6-15)25-21(26)19-11-17(23)12-24-20(19)13-27-18-9-7-16(22)8-10-18/h2-12,14H,13H2,1H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | BOZDABMKLRRMAG-AWEZNQCLSA-N |
| XLogP | 5.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |