C22H18ClFN2O4 — CID 75290936
4-[1-[[2-[(4-chlorophenoxy)methyl]-5-fluoropyridine-3-carbonyl]amino]ethyl]benzoic acid (PubChem CID 75290936) has the molecular formula C22H18ClFN2O4 and a molecular weight of 428.85 g/mol. Its IUPAC name is 4-[1-[[2-[(4-chlorophenoxy)methyl]-5-fluoropyridine-3-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[2-[(4-chlorophenoxy)methyl]-5-fluoropyridine-3-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 75290936 |
| Molecular Formula | C22H18ClFN2O4 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-[1-[[2-[(4-chlorophenoxy)methyl]-5-fluoropyridine-3-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)c1cc(F)cnc1COc1ccc(Cl)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H18ClFN2O4/c1-13(14-2-4-15(5-3-14)22(28)29)26-21(27)19-10-17(24)11-25-20(19)12-30-18-8-6-16(23)7-9-18/h2-11,13H,12H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | BTXUOUJHLMYLQA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |