C25H23NO3 — CID 10237427
3-[3-(1H-indol-5-yl)-4-[(2-methylphenyl)methoxy]phenyl]propanoic acid (PubChem CID 10237427) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[3-(1H-indol-5-yl)-4-[(2-methylphenyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-(1H-indol-5-yl)-4-[(2-methylphenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10237427 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 3-[3-(1H-indol-5-yl)-4-[(2-methylphenyl)methoxy]phenyl]propanoic acid |
| SMILES | Cc1ccccc1COc1ccc(CCC(=O)O)cc1-c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C25H23NO3/c1-17-4-2-3-5-21(17)16-29-24-10-6-18(7-11-25(27)28)14-22(24)19-8-9-23-20(15-19)12-13-26-23/h2-6,8-10,12-15,26H,7,11,16H2,1H3,(H,27,28) |
| InChIKey | HHMZNMJLSULFFA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |