C23H28N2O3 — CID 68828710
3-[4-(2-ethylbutoxy)-3-(1H-indazol-5-yl)phenyl]-2-methylpropanoic acid (PubChem CID 68828710) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[4-(2-ethylbutoxy)-3-(1H-indazol-5-yl)phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-(2-ethylbutoxy)-3-(1H-indazol-5-yl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68828710 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[4-(2-ethylbutoxy)-3-(1H-indazol-5-yl)phenyl]-2-methylpropanoic acid |
| SMILES | CCC(CC)COc1ccc(CC(C)C(=O)O)cc1-c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-16(5-2)14-28-22-9-6-17(10-15(3)23(26)27)11-20(22)18-7-8-21-19(12-18)13-24-25-21/h6-9,11-13,15-16H,4-5,10,14H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | OPYGUNVPHBKMJB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |