C18H5Cl10NO — CID 134623898
[3,6-bis(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol (PubChem CID 134623898) has the molecular formula C18H5Cl10NO and a molecular weight of 605.77 g/mol. Its IUPAC name is [3,6-bis(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol.
| Compound Name | [3,6-bis(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134623898 |
| Molecular Formula | C18H5Cl10NO |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 600.73 |
| IUPAC Name | [3,6-bis(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol |
| SMILES | OCc1nc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)ccc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H5Cl10NO/c19-9-7(10(20)14(24)17(27)13(9)23)4-1-2-5(29-6(4)3-30)8-11(21)15(25)18(28)16(26)12(8)22/h1-2,30H,3H2 |
| InChIKey | XKMBZCIPRMDLAH-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|