C12H5Cl6NO — CID 134626421
[3-chloro-6-(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol (PubChem CID 134626421) has the molecular formula C12H5Cl6NO and a molecular weight of 391.90 g/mol. Its IUPAC name is [3-chloro-6-(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol.
| Compound Name | [3-chloro-6-(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134626421 |
| Molecular Formula | C12H5Cl6NO |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 388.85 |
| IUPAC Name | [3-chloro-6-(2,3,4,5,6-pentachlorophenyl)-2-pyridinyl]methanol |
| SMILES | OCc1nc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)ccc1Cl |
| InChI | InChI=1S/C12H5Cl6NO/c13-4-1-2-5(19-6(4)3-20)7-8(14)10(16)12(18)11(17)9(7)15/h1-2,20H,3H2 |
| InChIKey | KXGVGFIMBGPVQT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|