methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate

C13H16O4 — CID 2300474

IUPACmethyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate
SMILESC=CCOc1c(C)c(O)cc(C)c1C(=O)OC
InChIInChI=1S/C13H16O4/c1-5-6-17-12-9(3)10(14)7-8(2)11(12)13(15)16-4/h5,7,14H,1,6H2,2-4H3
InChIKeyIFKJTBJOBVVIER-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.36
Rot. Bonds4

About methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate

methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate (PubChem CID 2300474) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate.

Molecular Properties

Compound Namemethyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate
PubChem CID2300474
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Namemethyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate
SMILESC=CCOc1c(C)c(O)cc(C)c1C(=O)OC
InChIInChI=1S/C13H16O4/c1-5-6-17-12-9(3)10(14)7-8(2)11(12)13(15)16-4/h5,7,14H,1,6H2,2-4H3
InChIKeyIFKJTBJOBVVIER-UHFFFAOYSA-N
XLogP2.36
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate?
The IUPAC name of methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate (CID 2300474) is methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate.
What is the SMILES notation for methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate?
The canonical SMILES for methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate is C=CCOc1c(C)c(O)cc(C)c1C(=O)OC.
What is the InChIKey of methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate?
The InChIKey is IFKJTBJOBVVIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-5-6-17-12-9(3)10(14)7-8(2)11(12)13(15)16-4/h5,7,14H,1,6H2,2-4H3.
What are the key properties of methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate?
methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate has a molecular weight of 236.27 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-3,6-dimethyl-2-prop-2-enoxybenzoate is sourced from PubChem (CID 2300474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).