C25H16Cl6N4O — CID 87294292
3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9-(2-phenoxyethyl)carbazole (PubChem CID 87294292) has the molecular formula C25H16Cl6N4O and a molecular weight of 601.15 g/mol. Its IUPAC name is 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9-(2-phenoxyethyl)carbazole.
| Compound Name | 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9-(2-phenoxyethyl)carbazole |
|---|---|
| PubChem CID | 87294292 |
| Molecular Formula | C25H16Cl6N4O |
| Molecular Weight | 601.15 g/mol |
| Exact Mass | 597.95 |
| IUPAC Name | 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9-(2-phenoxyethyl)carbazole |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccc3c(c2)c2ccccc2n3CCOc2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C25H16Cl6N4O/c26-24(27,28)22-32-21(33-23(34-22)25(29,30)31)15-10-11-20-18(14-15)17-8-4-5-9-19(17)35(20)12-13-36-16-6-2-1-3-7-16/h1-11,14H,12-13H2 |
| InChIKey | YXBLZEQYVSYZKL-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.15 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|