C37H30N4O2 — CID 146522505
9-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]ethyl]-3,6-dimethoxycarbazole (PubChem CID 146522505) has the molecular formula C37H30N4O2 and a molecular weight of 562.67 g/mol. Its IUPAC name is 9-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]ethyl]-3,6-dimethoxycarbazole.
| Compound Name | 9-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]ethyl]-3,6-dimethoxycarbazole |
|---|---|
| PubChem CID | 146522505 |
| Molecular Formula | C37H30N4O2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 9-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]ethyl]-3,6-dimethoxycarbazole |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2CCc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C37H30N4O2/c1-42-29-17-19-33-31(23-29)32-24-30(43-2)18-20-34(32)41(33)22-21-25-13-15-28(16-14-25)37-39-35(26-9-5-3-6-10-26)38-36(40-37)27-11-7-4-8-12-27/h3-20,23-24H,21-22H2,1-2H3 |
| InChIKey | HAZAQIGYASVRMR-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |