C15H11Cl6N3OS — CID 174965769
2-[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]butanethioic S-acid (PubChem CID 174965769) has the molecular formula C15H11Cl6N3OS and a molecular weight of 494.06 g/mol. Its IUPAC name is 2-[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]butanethioic S-acid.
| Compound Name | 2-[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]butanethioic S-acid |
|---|---|
| PubChem CID | 174965769 |
| Molecular Formula | C15H11Cl6N3OS |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 490.88 |
| IUPAC Name | 2-[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]butanethioic S-acid |
| SMILES | CCC(C(=O)S)c1cccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C15H11Cl6N3OS/c1-2-9(11(25)26)7-4-3-5-8(6-7)10-22-12(14(16,17)18)24-13(23-10)15(19,20)21/h3-6,9H,2H2,1H3,(H,25,26) |
| InChIKey | QSKWKXCPKAKZPS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|