C13H9Cl6N3 — CID 143216242
2,4-bis(trichloromethyl)-1,3,5-triazine;styrene (PubChem CID 143216242) has the molecular formula C13H9Cl6N3 and a molecular weight of 419.95 g/mol. Its IUPAC name is 2,4-bis(trichloromethyl)-1,3,5-triazine;styrene.
| Compound Name | 2,4-bis(trichloromethyl)-1,3,5-triazine;styrene |
|---|---|
| PubChem CID | 143216242 |
| Molecular Formula | C13H9Cl6N3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 416.89 |
| IUPAC Name | 2,4-bis(trichloromethyl)-1,3,5-triazine;styrene |
| SMILES | C=Cc1ccccc1.ClC(Cl)(Cl)c1ncnc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C8H8.C5HCl6N3/c1-2-8-6-4-3-5-7-8;6-4(7,8)2-12-1-13-3(14-2)5(9,10)11/h2-7H,1H2;1H |
| InChIKey | DATUZYAFBTZBNV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|