C19H18F2N2O4S — CID 8822661
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(3,4-difluorophenyl)sulfanylpropanoate (PubChem CID 8822661) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(3,4-difluorophenyl)sulfanylpropanoate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8822661 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
| SMILES | C[C@@H](OC(=O)CCSc1ccc(F)c(F)c1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18F2N2O4S/c1-12(18(25)22-23-19(26)13-5-3-2-4-6-13)27-17(24)9-10-28-14-7-8-15(20)16(21)11-14/h2-8,11-12H,9-10H2,1H3,(H,22,25)(H,23,26)/t12-/m1/s1 |
| InChIKey | GEWNXFZQHLSNKL-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|