C14H22F2N2S — CID 62576561
N-[2-(3,4-difluorophenyl)sulfanylethyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 62576561) has the molecular formula C14H22F2N2S and a molecular weight of 288.41 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)sulfanylethyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-(3,4-difluorophenyl)sulfanylethyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62576561 |
| Molecular Formula | C14H22F2N2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)sulfanylethyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H22F2N2S/c1-3-18(4-2)9-7-17-8-10-19-12-5-6-13(15)14(16)11-12/h5-6,11,17H,3-4,7-10H2,1-2H3 |
| InChIKey | QDJCZYLLGXJNNI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|