C11H16N4O2S — CID 63589022
5-[(6-amino-3-pyridinyl)sulfanylmethyl]oxolane-2-carbohydrazide (PubChem CID 63589022) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-[(6-amino-3-pyridinyl)sulfanylmethyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(6-amino-3-pyridinyl)sulfanylmethyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63589022 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-[(6-amino-3-pyridinyl)sulfanylmethyl]oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(CSc2ccc(N)nc2)O1 |
| InChI | InChI=1S/C11H16N4O2S/c12-10-4-2-8(5-14-10)18-6-7-1-3-9(17-7)11(16)15-13/h2,4-5,7,9H,1,3,6,13H2,(H2,12,14)(H,15,16) |
| InChIKey | FYZQHNLSXBFKTI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|