C12H17N3O2S — CID 63591696
5-[(4-aminophenyl)sulfanylmethyl]oxolane-2-carbohydrazide (PubChem CID 63591696) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-[(4-aminophenyl)sulfanylmethyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(4-aminophenyl)sulfanylmethyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63591696 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-[(4-aminophenyl)sulfanylmethyl]oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(CSc2ccc(N)cc2)O1 |
| InChI | InChI=1S/C12H17N3O2S/c13-8-1-4-10(5-2-8)18-7-9-3-6-11(17-9)12(16)15-14/h1-2,4-5,9,11H,3,6-7,13-14H2,(H,15,16) |
| InChIKey | RAYBANWHJBQVBF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|