C15H20O3S — CID 62300624
5-[(4-propan-2-ylphenyl)sulfanylmethyl]oxolane-2-carboxylic acid (PubChem CID 62300624) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 5-[(4-propan-2-ylphenyl)sulfanylmethyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(4-propan-2-ylphenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62300624 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[(4-propan-2-ylphenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
| SMILES | CC(C)c1ccc(SCC2CCC(C(=O)O)O2)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-10(2)11-3-6-13(7-4-11)19-9-12-5-8-14(18-12)15(16)17/h3-4,6-7,10,12,14H,5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | JMTNDALHWLIMMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |