C8H12N4O3S — CID 62299585
5-[(1-methyltetrazol-5-yl)sulfanylmethyl]oxolane-2-carboxylic acid (PubChem CID 62299585) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 5-[(1-methyltetrazol-5-yl)sulfanylmethyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(1-methyltetrazol-5-yl)sulfanylmethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62299585 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 5-[(1-methyltetrazol-5-yl)sulfanylmethyl]oxolane-2-carboxylic acid |
| SMILES | Cn1nnnc1SCC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C8H12N4O3S/c1-12-8(9-10-11-12)16-4-5-2-3-6(15-5)7(13)14/h5-6H,2-4H2,1H3,(H,13,14) |
| InChIKey | MRHQBQJMJCFDCI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |