C11H18N6O2S — CID 863319
N'-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]cyclohexanecarbohydrazide (PubChem CID 863319) has the molecular formula C11H18N6O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is N'-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 863319 |
| Molecular Formula | C11H18N6O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N'-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]cyclohexanecarbohydrazide |
| SMILES | Cn1nnnc1SCC(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H18N6O2S/c1-17-11(14-15-16-17)20-7-9(18)12-13-10(19)8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H,12,18)(H,13,19) |
| InChIKey | LQSRQRQMDXEKGR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|