C12H12Cl2O3S — CID 62298876
5-[(2,6-dichlorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid (PubChem CID 62298876) has the molecular formula C12H12Cl2O3S and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(2,6-dichlorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62298876 |
| Molecular Formula | C12H12Cl2O3S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CSc2c(Cl)cccc2Cl)O1 |
| InChI | InChI=1S/C12H12Cl2O3S/c13-8-2-1-3-9(14)11(8)18-6-7-4-5-10(17-7)12(15)16/h1-3,7,10H,4-6H2,(H,15,16) |
| InChIKey | CUQFDOGHOCAYCU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |