C12H18BrN3O3 — CID 102774570
4-[[bis(2-hydroxyethyl)amino]methyl]-3-bromobenzohydrazide (PubChem CID 102774570) has the molecular formula C12H18BrN3O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is 4-[[bis(2-hydroxyethyl)amino]methyl]-3-bromobenzohydrazide.
| Compound Name | 4-[[bis(2-hydroxyethyl)amino]methyl]-3-bromobenzohydrazide |
|---|---|
| PubChem CID | 102774570 |
| Molecular Formula | C12H18BrN3O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-[[bis(2-hydroxyethyl)amino]methyl]-3-bromobenzohydrazide |
| SMILES | NNC(=O)c1ccc(CN(CCO)CCO)c(Br)c1 |
| InChI | InChI=1S/C12H18BrN3O3/c13-11-7-9(12(19)15-14)1-2-10(11)8-16(3-5-17)4-6-18/h1-2,7,17-18H,3-6,8,14H2,(H,15,19) |
| InChIKey | HOIRMSBXHMIYOO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|