C10H15N7OS — CID 80979774
3-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 80979774) has the molecular formula C10H15N7OS and a molecular weight of 281.35 g/mol. Its IUPAC name is 3-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80979774 |
| Molecular Formula | C10H15N7OS |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)c1nc(NN)cc(Sc2n[nH]c(=O)n2C)n1 |
| InChI | InChI=1S/C10H15N7OS/c1-5(2)8-12-6(14-11)4-7(13-8)19-10-16-15-9(18)17(10)3/h4-5H,11H2,1-3H3,(H,15,18)(H,12,13,14) |
| InChIKey | GQGJYKNLTNEFBI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|