C11H16N6S2 — CID 80980095
[6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80980095) has the molecular formula C11H16N6S2 and a molecular weight of 296.43 g/mol. Its IUPAC name is [6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80980095 |
| Molecular Formula | C11H16N6S2 |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | CCc1nsc(Sc2cc(NN)nc(C(C)C)n2)n1 |
| InChI | InChI=1S/C11H16N6S2/c1-4-7-14-11(19-17-7)18-9-5-8(16-12)13-10(15-9)6(2)3/h5-6H,4,12H2,1-3H3,(H,13,15,16) |
| InChIKey | REYXBXXBRKLJJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|